C12H11N5O — CID 80515426
3-[(2-methoxy-3-pyridinyl)methylamino]pyridazine-4-carbonitrile (PubChem CID 80515426) has the molecular formula C12H11N5O and a molecular weight of 241.25 g/mol. Its IUPAC name is 3-[(2-methoxy-3-pyridinyl)methylamino]pyridazine-4-carbonitrile.
| Compound Name | 3-[(2-methoxy-3-pyridinyl)methylamino]pyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 80515426 |
| Molecular Formula | C12H11N5O |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 3-[(2-methoxy-3-pyridinyl)methylamino]pyridazine-4-carbonitrile |
| SMILES | COc1ncccc1CNc1nnccc1C#N |
| InChI | InChI=1S/C12H11N5O/c1-18-12-10(3-2-5-14-12)8-15-11-9(7-13)4-6-16-17-11/h2-6H,8H2,1H3,(H,15,17) |
| InChIKey | XDSNIXAWQPJQEX-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |