C14H14N4 — CID 80509735
3-[(2-ethylphenyl)methylamino]pyridazine-4-carbonitrile (PubChem CID 80509735) has the molecular formula C14H14N4 and a molecular weight of 238.29 g/mol. Its IUPAC name is 3-[(2-ethylphenyl)methylamino]pyridazine-4-carbonitrile.
| Compound Name | 3-[(2-ethylphenyl)methylamino]pyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 80509735 |
| Molecular Formula | C14H14N4 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 3-[(2-ethylphenyl)methylamino]pyridazine-4-carbonitrile |
| SMILES | CCc1ccccc1CNc1nnccc1C#N |
| InChI | InChI=1S/C14H14N4/c1-2-11-5-3-4-6-13(11)10-16-14-12(9-15)7-8-17-18-14/h3-8H,2,10H2,1H3,(H,16,18) |
| InChIKey | OBRXQOHPSJWEHO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |