C8H6N4 — CID 80509420
3-(prop-2-ynylamino)pyridazine-4-carbonitrile (PubChem CID 80509420) has the molecular formula C8H6N4 and a molecular weight of 158.16 g/mol. Its IUPAC name is 3-(prop-2-ynylamino)pyridazine-4-carbonitrile.
| Compound Name | 3-(prop-2-ynylamino)pyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 80509420 |
| Molecular Formula | C8H6N4 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | 3-(prop-2-ynylamino)pyridazine-4-carbonitrile |
| SMILES | C#CCNc1nnccc1C#N |
| InChI | InChI=1S/C8H6N4/c1-2-4-10-8-7(6-9)3-5-11-12-8/h1,3,5H,4H2,(H,10,12) |
| InChIKey | JPTZWAYWWTVABR-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|