C9H10N4O2 — CID 80510253
methyl 3-[(4-cyanopyridazin-3-yl)amino]propanoate (PubChem CID 80510253) has the molecular formula C9H10N4O2 and a molecular weight of 206.21 g/mol. Its IUPAC name is methyl 3-[(4-cyanopyridazin-3-yl)amino]propanoate.
| Compound Name | methyl 3-[(4-cyanopyridazin-3-yl)amino]propanoate |
|---|---|
| PubChem CID | 80510253 |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | methyl 3-[(4-cyanopyridazin-3-yl)amino]propanoate |
| SMILES | COC(=O)CCNc1nnccc1C#N |
| InChI | InChI=1S/C9H10N4O2/c1-15-8(14)3-4-11-9-7(6-10)2-5-12-13-9/h2,5H,3-4H2,1H3,(H,11,13) |
| InChIKey | JLACORMIHXJTCV-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |