C11H9N3S — CID 60965511
2-(thiophen-3-ylmethylamino)pyridine-3-carbonitrile (PubChem CID 60965511) has the molecular formula C11H9N3S and a molecular weight of 215.28 g/mol. Its IUPAC name is 2-(thiophen-3-ylmethylamino)pyridine-3-carbonitrile.
| Compound Name | 2-(thiophen-3-ylmethylamino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 60965511 |
| Molecular Formula | C11H9N3S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | 2-(thiophen-3-ylmethylamino)pyridine-3-carbonitrile |
| SMILES | N#Cc1cccnc1NCc1ccsc1 |
| InChI | InChI=1S/C11H9N3S/c12-6-10-2-1-4-13-11(10)14-7-9-3-5-15-8-9/h1-5,8H,7H2,(H,13,14) |
| InChIKey | DFCHJZLZIHDFGB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |