C16H20N2O3 — CID 78914081
methyl 5-[[3-(dimethylamino)anilino]methyl]-2-methylfuran-3-carboxylate (PubChem CID 78914081) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is methyl 5-[[3-(dimethylamino)anilino]methyl]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[[3-(dimethylamino)anilino]methyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 78914081 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | methyl 5-[[3-(dimethylamino)anilino]methyl]-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1cc(CNc2cccc(N(C)C)c2)oc1C |
| InChI | InChI=1S/C16H20N2O3/c1-11-15(16(19)20-4)9-14(21-11)10-17-12-6-5-7-13(8-12)18(2)3/h5-9,17H,10H2,1-4H3 |
| InChIKey | NFJJZSOJJYROJN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |