C13H15IN2O — CID 113297515
1-N-[(5-iodofuran-2-yl)methyl]-3-N,3-N-dimethylbenzene-1,3-diamine (PubChem CID 113297515) has the molecular formula C13H15IN2O and a molecular weight of 342.18 g/mol. Its IUPAC name is 1-N-[(5-iodofuran-2-yl)methyl]-3-N,3-N-dimethylbenzene-1,3-diamine.
| Compound Name | 1-N-[(5-iodofuran-2-yl)methyl]-3-N,3-N-dimethylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 113297515 |
| Molecular Formula | C13H15IN2O |
| Molecular Weight | 342.18 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | 1-N-[(5-iodofuran-2-yl)methyl]-3-N,3-N-dimethylbenzene-1,3-diamine |
| SMILES | CN(C)c1cccc(NCc2ccc(I)o2)c1 |
| InChI | InChI=1S/C13H15IN2O/c1-16(2)11-5-3-4-10(8-11)15-9-12-6-7-13(14)17-12/h3-8,15H,9H2,1-2H3 |
| InChIKey | JHLPWUMXGDGFCW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.18 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|