C11H12IN3O3S — CID 43790228
2-iodo-5-[[3-(sulfamoylamino)anilino]methyl]furan (PubChem CID 43790228) has the molecular formula C11H12IN3O3S and a molecular weight of 393.21 g/mol. Its IUPAC name is 2-iodo-5-[[3-(sulfamoylamino)anilino]methyl]furan.
| Compound Name | 2-iodo-5-[[3-(sulfamoylamino)anilino]methyl]furan |
|---|---|
| PubChem CID | 43790228 |
| Molecular Formula | C11H12IN3O3S |
| Molecular Weight | 393.21 g/mol |
| Exact Mass | 392.96 |
| IUPAC Name | 2-iodo-5-[[3-(sulfamoylamino)anilino]methyl]furan |
| SMILES | NS(=O)(=O)Nc1cccc(NCc2ccc(I)o2)c1 |
| InChI | InChI=1S/C11H12IN3O3S/c12-11-5-4-10(18-11)7-14-8-2-1-3-9(6-8)15-19(13,16)17/h1-6,14-15H,7H2,(H2,13,16,17) |
| InChIKey | HHLGRUSXPMOVDM-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.21 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|