C11H14N4O2S2 — CID 54868489
2-methyl-5-[[3-(sulfamoylamino)anilino]methyl]-1,3-thiazole (PubChem CID 54868489) has the molecular formula C11H14N4O2S2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 2-methyl-5-[[3-(sulfamoylamino)anilino]methyl]-1,3-thiazole.
| Compound Name | 2-methyl-5-[[3-(sulfamoylamino)anilino]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 54868489 |
| Molecular Formula | C11H14N4O2S2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 2-methyl-5-[[3-(sulfamoylamino)anilino]methyl]-1,3-thiazole |
| SMILES | Cc1ncc(CNc2cccc(NS(N)(=O)=O)c2)s1 |
| InChI | InChI=1S/C11H14N4O2S2/c1-8-13-6-11(18-8)7-14-9-3-2-4-10(5-9)15-19(12,16)17/h2-6,14-15H,7H2,1H3,(H2,12,16,17) |
| InChIKey | BEWCUXLZMAWOMO-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |