C11H15N5O2S — CID 43742059
5-methyl-4-[[3-(sulfamoylamino)anilino]methyl]-1H-pyrazole (PubChem CID 43742059) has the molecular formula C11H15N5O2S and a molecular weight of 281.34 g/mol. Its IUPAC name is 5-methyl-4-[[3-(sulfamoylamino)anilino]methyl]-1H-pyrazole.
| Compound Name | 5-methyl-4-[[3-(sulfamoylamino)anilino]methyl]-1H-pyrazole |
|---|---|
| PubChem CID | 43742059 |
| Molecular Formula | C11H15N5O2S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 5-methyl-4-[[3-(sulfamoylamino)anilino]methyl]-1H-pyrazole |
| SMILES | Cc1[nH]ncc1CNc1cccc(NS(N)(=O)=O)c1 |
| InChI | InChI=1S/C11H15N5O2S/c1-8-9(7-14-15-8)6-13-10-3-2-4-11(5-10)16-19(12,17)18/h2-5,7,13,16H,6H2,1H3,(H,14,15)(H2,12,17,18) |
| InChIKey | LDUYOIMJOVVATQ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |