About 2-ethyl-5-[[3-(sulfamoylamino)anilino]methyl]-1,3-thiazole
2-ethyl-5-[[3-(sulfamoylamino)anilino]methyl]-1,3-thiazole (PubChem CID 60983417) has the molecular formula C12H16N4O2S2
and a molecular weight of 312.42 g/mol. Its IUPAC name is 2-ethyl-5-[[3-(sulfamoylamino)anilino]methyl]-1,3-thiazole.
Molecular Properties
| Compound Name | 2-ethyl-5-[[3-(sulfamoylamino)anilino]methyl]-1,3-thiazole |
| PubChem CID | 60983417 |
| Molecular Formula | C12H16N4O2S2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 2-ethyl-5-[[3-(sulfamoylamino)anilino]methyl]-1,3-thiazole |
| SMILES | CCc1ncc(CNc2cccc(NS(N)(=O)=O)c2)s1 |
| InChI | InChI=1S/C12H16N4O2S2/c1-2-12-15-8-11(19-12)7-14-9-4-3-5-10(6-9)16-20(13,17)18/h3-6,8,14,16H,2,7H2,1H3,(H2,13,17,18) |
| InChIKey | MSAFWPKNSQFFPV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-ethyl-5-[[3-(sulfamoylamino)anilino]methyl]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-5-[[3-(sulfamoylamino)anilino]methyl]-1,3-thiazole?
The IUPAC name of 2-ethyl-5-[[3-(sulfamoylamino)anilino]methyl]-1,3-thiazole (CID 60983417) is 2-ethyl-5-[[3-(sulfamoylamino)anilino]methyl]-1,3-thiazole.
What is the SMILES notation for 2-ethyl-5-[[3-(sulfamoylamino)anilino]methyl]-1,3-thiazole?
The canonical SMILES for 2-ethyl-5-[[3-(sulfamoylamino)anilino]methyl]-1,3-thiazole is CCc1ncc(CNc2cccc(NS(N)(=O)=O)c2)s1.
What is the InChIKey of 2-ethyl-5-[[3-(sulfamoylamino)anilino]methyl]-1,3-thiazole?
The InChIKey is MSAFWPKNSQFFPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4O2S2/c1-2-12-15-8-11(19-12)7-14-9-4-3-5-10(6-9)16-20(13,17)18/h3-6,8,14,16H,2,7H2,1H3,(H2,13,17,18).
What are the key properties of 2-ethyl-5-[[3-(sulfamoylamino)anilino]methyl]-1,3-thiazole?
2-ethyl-5-[[3-(sulfamoylamino)anilino]methyl]-1,3-thiazole has a molecular weight of 312.42 g/mol, XLogP of 1.93, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-5-[[3-(sulfamoylamino)anilino]methyl]-1,3-thiazole is sourced from PubChem (CID 60983417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).