C16H22N2S — CID 54883751
4-tert-butyl-N-[(2-ethyl-1,3-thiazol-5-yl)methyl]aniline (PubChem CID 54883751) has the molecular formula C16H22N2S and a molecular weight of 274.43 g/mol. Its IUPAC name is 4-tert-butyl-N-[(2-ethyl-1,3-thiazol-5-yl)methyl]aniline.
| Compound Name | 4-tert-butyl-N-[(2-ethyl-1,3-thiazol-5-yl)methyl]aniline |
|---|---|
| PubChem CID | 54883751 |
| Molecular Formula | C16H22N2S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 4-tert-butyl-N-[(2-ethyl-1,3-thiazol-5-yl)methyl]aniline |
| SMILES | CCc1ncc(CNc2ccc(C(C)(C)C)cc2)s1 |
| InChI | InChI=1S/C16H22N2S/c1-5-15-18-11-14(19-15)10-17-13-8-6-12(7-9-13)16(2,3)4/h6-9,11,17H,5,10H2,1-4H3 |
| InChIKey | ZTCMUZPORIWGBI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |