C14H17IN2S — CID 112755253
4-tert-butyl-N-[(5-iodo-1,3-thiazol-2-yl)methyl]aniline (PubChem CID 112755253) has the molecular formula C14H17IN2S and a molecular weight of 372.28 g/mol. Its IUPAC name is 4-tert-butyl-N-[(5-iodo-1,3-thiazol-2-yl)methyl]aniline.
| Compound Name | 4-tert-butyl-N-[(5-iodo-1,3-thiazol-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 112755253 |
| Molecular Formula | C14H17IN2S |
| Molecular Weight | 372.28 g/mol |
| Exact Mass | 372.02 |
| IUPAC Name | 4-tert-butyl-N-[(5-iodo-1,3-thiazol-2-yl)methyl]aniline |
| SMILES | CC(C)(C)c1ccc(NCc2ncc(I)s2)cc1 |
| InChI | InChI=1S/C14H17IN2S/c1-14(2,3)10-4-6-11(7-5-10)16-9-13-17-8-12(15)18-13/h4-8,16H,9H2,1-3H3 |
| InChIKey | DERFFNHRLLNOJH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.28 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|