C10H12N4S — CID 107588313
N-[(2-ethyl-1,3-thiazol-5-yl)methyl]pyrimidin-5-amine (PubChem CID 107588313) has the molecular formula C10H12N4S and a molecular weight of 220.30 g/mol. Its IUPAC name is N-[(2-ethyl-1,3-thiazol-5-yl)methyl]pyrimidin-5-amine.
| Compound Name | N-[(2-ethyl-1,3-thiazol-5-yl)methyl]pyrimidin-5-amine |
|---|---|
| PubChem CID | 107588313 |
| Molecular Formula | C10H12N4S |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | N-[(2-ethyl-1,3-thiazol-5-yl)methyl]pyrimidin-5-amine |
| SMILES | CCc1ncc(CNc2cncnc2)s1 |
| InChI | InChI=1S/C10H12N4S/c1-2-10-14-6-9(15-10)5-13-8-3-11-7-12-4-8/h3-4,6-7,13H,2,5H2,1H3 |
| InChIKey | DOXNMSMZGLGCDU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |