C14H18N4OS — CID 60983648
1-[4-[(2-ethyl-1,3-thiazol-5-yl)methylamino]phenyl]-3-methylurea (PubChem CID 60983648) has the molecular formula C14H18N4OS and a molecular weight of 290.39 g/mol. Its IUPAC name is 1-[4-[(2-ethyl-1,3-thiazol-5-yl)methylamino]phenyl]-3-methylurea.
| Compound Name | 1-[4-[(2-ethyl-1,3-thiazol-5-yl)methylamino]phenyl]-3-methylurea |
|---|---|
| PubChem CID | 60983648 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 1-[4-[(2-ethyl-1,3-thiazol-5-yl)methylamino]phenyl]-3-methylurea |
| SMILES | CCc1ncc(CNc2ccc(NC(=O)NC)cc2)s1 |
| InChI | InChI=1S/C14H18N4OS/c1-3-13-17-9-12(20-13)8-16-10-4-6-11(7-5-10)18-14(19)15-2/h4-7,9,16H,3,8H2,1-2H3,(H2,15,18,19) |
| InChIKey | DZLJLWXMZYRUAH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |