C13H14F2N2OS — CID 54883371
4-(difluoromethoxy)-N-[(2-ethyl-1,3-thiazol-5-yl)methyl]aniline (PubChem CID 54883371) has the molecular formula C13H14F2N2OS and a molecular weight of 284.33 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-[(2-ethyl-1,3-thiazol-5-yl)methyl]aniline.
| Compound Name | 4-(difluoromethoxy)-N-[(2-ethyl-1,3-thiazol-5-yl)methyl]aniline |
|---|---|
| PubChem CID | 54883371 |
| Molecular Formula | C13H14F2N2OS |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 4-(difluoromethoxy)-N-[(2-ethyl-1,3-thiazol-5-yl)methyl]aniline |
| SMILES | CCc1ncc(CNc2ccc(OC(F)F)cc2)s1 |
| InChI | InChI=1S/C13H14F2N2OS/c1-2-12-17-8-11(19-12)7-16-9-3-5-10(6-4-9)18-13(14)15/h3-6,8,13,16H,2,7H2,1H3 |
| InChIKey | GTFNZAVMROUVCO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|