C12H14ClN3O2S2 — CID 60983542
4-chloro-3-[(2-ethyl-1,3-thiazol-5-yl)methylamino]benzenesulfonamide (PubChem CID 60983542) has the molecular formula C12H14ClN3O2S2 and a molecular weight of 331.85 g/mol. Its IUPAC name is 4-chloro-3-[(2-ethyl-1,3-thiazol-5-yl)methylamino]benzenesulfonamide.
| Compound Name | 4-chloro-3-[(2-ethyl-1,3-thiazol-5-yl)methylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 60983542 |
| Molecular Formula | C12H14ClN3O2S2 |
| Molecular Weight | 331.85 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 4-chloro-3-[(2-ethyl-1,3-thiazol-5-yl)methylamino]benzenesulfonamide |
| SMILES | CCc1ncc(CNc2cc(S(N)(=O)=O)ccc2Cl)s1 |
| InChI | InChI=1S/C12H14ClN3O2S2/c1-2-12-16-7-8(19-12)6-15-11-5-9(20(14,17)18)3-4-10(11)13/h3-5,7,15H,2,6H2,1H3,(H2,14,17,18) |
| InChIKey | RABXGIDIJVVUNR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.85 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |