C12H12BrClN2S — CID 81263663
2-bromo-4-chloro-N-[(2-ethyl-1,3-thiazol-5-yl)methyl]aniline (PubChem CID 81263663) has the molecular formula C12H12BrClN2S and a molecular weight of 331.67 g/mol. Its IUPAC name is 2-bromo-4-chloro-N-[(2-ethyl-1,3-thiazol-5-yl)methyl]aniline.
| Compound Name | 2-bromo-4-chloro-N-[(2-ethyl-1,3-thiazol-5-yl)methyl]aniline |
|---|---|
| PubChem CID | 81263663 |
| Molecular Formula | C12H12BrClN2S |
| Molecular Weight | 331.67 g/mol |
| Exact Mass | 329.96 |
| IUPAC Name | 2-bromo-4-chloro-N-[(2-ethyl-1,3-thiazol-5-yl)methyl]aniline |
| SMILES | CCc1ncc(CNc2ccc(Cl)cc2Br)s1 |
| InChI | InChI=1S/C12H12BrClN2S/c1-2-12-16-7-9(17-12)6-15-11-4-3-8(14)5-10(11)13/h3-5,7,15H,2,6H2,1H3 |
| InChIKey | RGTPTZYIRVHIAP-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.67 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |