C13H16N2OS — CID 54883557
N-[(2-ethyl-1,3-thiazol-5-yl)methyl]-2-methoxyaniline (PubChem CID 54883557) has the molecular formula C13H16N2OS and a molecular weight of 248.35 g/mol. Its IUPAC name is N-[(2-ethyl-1,3-thiazol-5-yl)methyl]-2-methoxyaniline.
| Compound Name | N-[(2-ethyl-1,3-thiazol-5-yl)methyl]-2-methoxyaniline |
|---|---|
| PubChem CID | 54883557 |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | N-[(2-ethyl-1,3-thiazol-5-yl)methyl]-2-methoxyaniline |
| SMILES | CCc1ncc(CNc2ccccc2OC)s1 |
| InChI | InChI=1S/C13H16N2OS/c1-3-13-15-9-10(17-13)8-14-11-6-4-5-7-12(11)16-2/h4-7,9,14H,3,8H2,1-2H3 |
| InChIKey | REBUVUBPGJAFSX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |