C14H16N2O3S — CID 63742291
3-[(2-ethyl-1,3-thiazol-5-yl)methylamino]-4-methoxybenzoic acid (PubChem CID 63742291) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is 3-[(2-ethyl-1,3-thiazol-5-yl)methylamino]-4-methoxybenzoic acid.
| Compound Name | 3-[(2-ethyl-1,3-thiazol-5-yl)methylamino]-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 63742291 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 3-[(2-ethyl-1,3-thiazol-5-yl)methylamino]-4-methoxybenzoic acid |
| SMILES | CCc1ncc(CNc2cc(C(=O)O)ccc2OC)s1 |
| InChI | InChI=1S/C14H16N2O3S/c1-3-13-16-8-10(20-13)7-15-11-6-9(14(17)18)4-5-12(11)19-2/h4-6,8,15H,3,7H2,1-2H3,(H,17,18) |
| InChIKey | NYYBUMBZMCLYAZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |