C14H17N3OS — CID 54883427
3-[(2-ethyl-1,3-thiazol-5-yl)methylamino]-2-methylbenzamide (PubChem CID 54883427) has the molecular formula C14H17N3OS and a molecular weight of 275.38 g/mol. Its IUPAC name is 3-[(2-ethyl-1,3-thiazol-5-yl)methylamino]-2-methylbenzamide.
| Compound Name | 3-[(2-ethyl-1,3-thiazol-5-yl)methylamino]-2-methylbenzamide |
|---|---|
| PubChem CID | 54883427 |
| Molecular Formula | C14H17N3OS |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 3-[(2-ethyl-1,3-thiazol-5-yl)methylamino]-2-methylbenzamide |
| SMILES | CCc1ncc(CNc2cccc(C(N)=O)c2C)s1 |
| InChI | InChI=1S/C14H17N3OS/c1-3-13-17-8-10(19-13)7-16-12-6-4-5-11(9(12)2)14(15)18/h4-6,8,16H,3,7H2,1-2H3,(H2,15,18) |
| InChIKey | VMJAHHYZYPMIQK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |