C14H16N2OS — CID 43694008
2-methyl-3-[(5-methylthiophen-2-yl)methylamino]benzamide (PubChem CID 43694008) has the molecular formula C14H16N2OS and a molecular weight of 260.36 g/mol. Its IUPAC name is 2-methyl-3-[(5-methylthiophen-2-yl)methylamino]benzamide.
| Compound Name | 2-methyl-3-[(5-methylthiophen-2-yl)methylamino]benzamide |
|---|---|
| PubChem CID | 43694008 |
| Molecular Formula | C14H16N2OS |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 2-methyl-3-[(5-methylthiophen-2-yl)methylamino]benzamide |
| SMILES | Cc1ccc(CNc2cccc(C(N)=O)c2C)s1 |
| InChI | InChI=1S/C14H16N2OS/c1-9-6-7-11(18-9)8-16-13-5-3-4-12(10(13)2)14(15)17/h3-7,16H,8H2,1-2H3,(H2,15,17) |
| InChIKey | MXJJNPZDYTYMIE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |