C13H17N3O2S2 — CID 60982357
4-[[(2-ethyl-1,3-thiazol-5-yl)methylamino]methyl]benzenesulfonamide (PubChem CID 60982357) has the molecular formula C13H17N3O2S2 and a molecular weight of 311.43 g/mol. Its IUPAC name is 4-[[(2-ethyl-1,3-thiazol-5-yl)methylamino]methyl]benzenesulfonamide.
| Compound Name | 4-[[(2-ethyl-1,3-thiazol-5-yl)methylamino]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 60982357 |
| Molecular Formula | C13H17N3O2S2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 4-[[(2-ethyl-1,3-thiazol-5-yl)methylamino]methyl]benzenesulfonamide |
| SMILES | CCc1ncc(CNCc2ccc(S(N)(=O)=O)cc2)s1 |
| InChI | InChI=1S/C13H17N3O2S2/c1-2-13-16-9-11(19-13)8-15-7-10-3-5-12(6-4-10)20(14,17)18/h3-6,9,15H,2,7-8H2,1H3,(H2,14,17,18) |
| InChIKey | WKRATXYWKWGMPR-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |