C16H23N3O2S2 — CID 119126639
4-[2-[(2-tert-butyl-1,3-thiazol-5-yl)methylamino]ethyl]benzenesulfonamide (PubChem CID 119126639) has the molecular formula C16H23N3O2S2 and a molecular weight of 353.51 g/mol. Its IUPAC name is 4-[2-[(2-tert-butyl-1,3-thiazol-5-yl)methylamino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[(2-tert-butyl-1,3-thiazol-5-yl)methylamino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 119126639 |
| Molecular Formula | C16H23N3O2S2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 4-[2-[(2-tert-butyl-1,3-thiazol-5-yl)methylamino]ethyl]benzenesulfonamide |
| SMILES | CC(C)(C)c1ncc(CNCCc2ccc(S(N)(=O)=O)cc2)s1 |
| InChI | InChI=1S/C16H23N3O2S2/c1-16(2,3)15-19-11-13(22-15)10-18-9-8-12-4-6-14(7-5-12)23(17,20)21/h4-7,11,18H,8-10H2,1-3H3,(H2,17,20,21) |
| InChIKey | LBGSLGGKZIDQTI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|