C12H13N3O2S — CID 54883766
N-[(2-ethyl-1,3-thiazol-5-yl)methyl]-3-nitroaniline (PubChem CID 54883766) has the molecular formula C12H13N3O2S and a molecular weight of 263.32 g/mol. Its IUPAC name is N-[(2-ethyl-1,3-thiazol-5-yl)methyl]-3-nitroaniline.
| Compound Name | N-[(2-ethyl-1,3-thiazol-5-yl)methyl]-3-nitroaniline |
|---|---|
| PubChem CID | 54883766 |
| Molecular Formula | C12H13N3O2S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | N-[(2-ethyl-1,3-thiazol-5-yl)methyl]-3-nitroaniline |
| SMILES | CCc1ncc(CNc2cccc([N+](=O)[O-])c2)s1 |
| InChI | InChI=1S/C12H13N3O2S/c1-2-12-14-8-11(18-12)7-13-9-4-3-5-10(6-9)15(16)17/h3-6,8,13H,2,7H2,1H3 |
| InChIKey | LVDACBFLZTWBNQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|