C12H19ClN2O5S2 — CID 119959228
methyl 5-(4-aminopiperidin-1-yl)sulfonyl-4-methoxythiophene-2-carboxylate;hydrochloride (PubChem CID 119959228) has the molecular formula C12H19ClN2O5S2 and a molecular weight of 370.88 g/mol. Its IUPAC name is methyl 5-(4-aminopiperidin-1-yl)sulfonyl-4-methoxythiophene-2-carboxylate;hydrochloride.
| Compound Name | methyl 5-(4-aminopiperidin-1-yl)sulfonyl-4-methoxythiophene-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 119959228 |
| Molecular Formula | C12H19ClN2O5S2 |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | methyl 5-(4-aminopiperidin-1-yl)sulfonyl-4-methoxythiophene-2-carboxylate;hydrochloride |
| SMILES | COC(=O)c1cc(OC)c(S(=O)(=O)N2CCC(N)CC2)s1.Cl |
| InChI | InChI=1S/C12H18N2O5S2.ClH/c1-18-9-7-10(11(15)19-2)20-12(9)21(16,17)14-5-3-8(13)4-6-14;/h7-8H,3-6,13H2,1-2H3;1H |
| InChIKey | ZEVRPJXDOHIKTG-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |