C14H22N2O5S2 — CID 119978369
methyl 4-methoxy-5-[4-(methylaminomethyl)piperidin-1-yl]sulfonylthiophene-2-carboxylate (PubChem CID 119978369) has the molecular formula C14H22N2O5S2 and a molecular weight of 362.47 g/mol. Its IUPAC name is methyl 4-methoxy-5-[4-(methylaminomethyl)piperidin-1-yl]sulfonylthiophene-2-carboxylate.
| Compound Name | methyl 4-methoxy-5-[4-(methylaminomethyl)piperidin-1-yl]sulfonylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 119978369 |
| Molecular Formula | C14H22N2O5S2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | methyl 4-methoxy-5-[4-(methylaminomethyl)piperidin-1-yl]sulfonylthiophene-2-carboxylate |
| SMILES | CNCC1CCN(S(=O)(=O)c2sc(C(=O)OC)cc2OC)CC1 |
| InChI | InChI=1S/C14H22N2O5S2/c1-15-9-10-4-6-16(7-5-10)23(18,19)14-11(20-2)8-12(22-14)13(17)21-3/h8,10,15H,4-7,9H2,1-3H3 |
| InChIKey | VTORRNRIGLLAKE-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |