C15H24N2O6S2 — CID 119992720
methyl 5-[4-(3-aminopropoxy)piperidin-1-yl]sulfonyl-4-methoxythiophene-2-carboxylate (PubChem CID 119992720) has the molecular formula C15H24N2O6S2 and a molecular weight of 392.50 g/mol. Its IUPAC name is methyl 5-[4-(3-aminopropoxy)piperidin-1-yl]sulfonyl-4-methoxythiophene-2-carboxylate.
| Compound Name | methyl 5-[4-(3-aminopropoxy)piperidin-1-yl]sulfonyl-4-methoxythiophene-2-carboxylate |
|---|---|
| PubChem CID | 119992720 |
| Molecular Formula | C15H24N2O6S2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | methyl 5-[4-(3-aminopropoxy)piperidin-1-yl]sulfonyl-4-methoxythiophene-2-carboxylate |
| SMILES | COC(=O)c1cc(OC)c(S(=O)(=O)N2CCC(OCCCN)CC2)s1 |
| InChI | InChI=1S/C15H24N2O6S2/c1-21-12-10-13(14(18)22-2)24-15(12)25(19,20)17-7-4-11(5-8-17)23-9-3-6-16/h10-11H,3-9,16H2,1-2H3 |
| InChIKey | QCBXULVCSNYQFT-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 108.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|