C13H19ClN2O4S — CID 119961823
methyl 4-methyl-3-piperazin-1-ylsulfonylbenzoate;hydrochloride (PubChem CID 119961823) has the molecular formula C13H19ClN2O4S and a molecular weight of 334.83 g/mol. Its IUPAC name is methyl 4-methyl-3-piperazin-1-ylsulfonylbenzoate;hydrochloride.
| Compound Name | methyl 4-methyl-3-piperazin-1-ylsulfonylbenzoate;hydrochloride |
|---|---|
| PubChem CID | 119961823 |
| Molecular Formula | C13H19ClN2O4S |
| Molecular Weight | 334.83 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | methyl 4-methyl-3-piperazin-1-ylsulfonylbenzoate;hydrochloride |
| SMILES | COC(=O)c1ccc(C)c(S(=O)(=O)N2CCNCC2)c1.Cl |
| InChI | InChI=1S/C13H18N2O4S.ClH/c1-10-3-4-11(13(16)19-2)9-12(10)20(17,18)15-7-5-14-6-8-15;/h3-4,9,14H,5-8H2,1-2H3;1H |
| InChIKey | JCUHJJYLLRRNDL-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.83 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |