C13H17NO5S — CID 62916612
methyl 3-(3-hydroxypyrrolidin-1-yl)sulfonyl-4-methylbenzoate (PubChem CID 62916612) has the molecular formula C13H17NO5S and a molecular weight of 299.35 g/mol. Its IUPAC name is methyl 3-(3-hydroxypyrrolidin-1-yl)sulfonyl-4-methylbenzoate.
| Compound Name | methyl 3-(3-hydroxypyrrolidin-1-yl)sulfonyl-4-methylbenzoate |
|---|---|
| PubChem CID | 62916612 |
| Molecular Formula | C13H17NO5S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | methyl 3-(3-hydroxypyrrolidin-1-yl)sulfonyl-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(S(=O)(=O)N2CCC(O)C2)c1 |
| InChI | InChI=1S/C13H17NO5S/c1-9-3-4-10(13(16)19-2)7-12(9)20(17,18)14-6-5-11(15)8-14/h3-4,7,11,15H,5-6,8H2,1-2H3 |
| InChIKey | WEBQWDOTQUNXDJ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |