C16H24ClN3O5S — CID 119967573
methyl 4-methyl-3-[methyl-(2-oxo-2-piperazin-1-ylethyl)sulfamoyl]benzoate;hydrochloride (PubChem CID 119967573) has the molecular formula C16H24ClN3O5S and a molecular weight of 405.90 g/mol. Its IUPAC name is methyl 4-methyl-3-[methyl-(2-oxo-2-piperazin-1-ylethyl)sulfamoyl]benzoate;hydrochloride.
| Compound Name | methyl 4-methyl-3-[methyl-(2-oxo-2-piperazin-1-ylethyl)sulfamoyl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 119967573 |
| Molecular Formula | C16H24ClN3O5S |
| Molecular Weight | 405.90 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | methyl 4-methyl-3-[methyl-(2-oxo-2-piperazin-1-ylethyl)sulfamoyl]benzoate;hydrochloride |
| SMILES | COC(=O)c1ccc(C)c(S(=O)(=O)N(C)CC(=O)N2CCNCC2)c1.Cl |
| InChI | InChI=1S/C16H23N3O5S.ClH/c1-12-4-5-13(16(21)24-3)10-14(12)25(22,23)18(2)11-15(20)19-8-6-17-7-9-19;/h4-5,10,17H,6-9,11H2,1-3H3;1H |
| InChIKey | NGXHYKDVLKBFLW-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.90 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |