C19H22N2O3S — CID 51123507
N-[2-(3,4-dihydro-2H-quinolin-1-yl)ethyl]-3-methylsulfonylbenzamide (PubChem CID 51123507) has the molecular formula C19H22N2O3S and a molecular weight of 358.46 g/mol. Its IUPAC name is N-[2-(3,4-dihydro-2H-quinolin-1-yl)ethyl]-3-methylsulfonylbenzamide.
| Compound Name | N-[2-(3,4-dihydro-2H-quinolin-1-yl)ethyl]-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 51123507 |
| Molecular Formula | C19H22N2O3S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | N-[2-(3,4-dihydro-2H-quinolin-1-yl)ethyl]-3-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1cccc(C(=O)NCCN2CCCc3ccccc32)c1 |
| InChI | InChI=1S/C19H22N2O3S/c1-25(23,24)17-9-4-7-16(14-17)19(22)20-11-13-21-12-5-8-15-6-2-3-10-18(15)21/h2-4,6-7,9-10,14H,5,8,11-13H2,1H3,(H,20,22) |
| InChIKey | PJYQWKWHSBQWRC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |