C20H25N3O3S — CID 72864977
1-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-3-(4-methylsulfonylphenyl)urea (PubChem CID 72864977) has the molecular formula C20H25N3O3S and a molecular weight of 387.51 g/mol. Its IUPAC name is 1-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-3-(4-methylsulfonylphenyl)urea.
| Compound Name | 1-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-3-(4-methylsulfonylphenyl)urea |
|---|---|
| PubChem CID | 72864977 |
| Molecular Formula | C20H25N3O3S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 1-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-3-(4-methylsulfonylphenyl)urea |
| SMILES | CS(=O)(=O)c1ccc(NC(=O)NCCCN2CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C20H25N3O3S/c1-27(25,26)18-11-9-17(10-12-18)22-20(24)21-13-5-15-23-14-4-7-16-6-2-3-8-19(16)23/h2-3,6,8-12H,4-5,7,13-15H2,1H3,(H2,21,22,24) |
| InChIKey | LGEUDPSBZAKFHV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|