C17H21NO5S2 — CID 96542928
N-[(2R)-4-hydroxy-2-phenylbutyl]-3-methylsulfonylbenzenesulfonamide (PubChem CID 96542928) has the molecular formula C17H21NO5S2 and a molecular weight of 383.49 g/mol. Its IUPAC name is N-[(2R)-4-hydroxy-2-phenylbutyl]-3-methylsulfonylbenzenesulfonamide.
| Compound Name | N-[(2R)-4-hydroxy-2-phenylbutyl]-3-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 96542928 |
| Molecular Formula | C17H21NO5S2 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | N-[(2R)-4-hydroxy-2-phenylbutyl]-3-methylsulfonylbenzenesulfonamide |
| SMILES | CS(=O)(=O)c1cccc(S(=O)(=O)NC[C@H](CCO)c2ccccc2)c1 |
| InChI | InChI=1S/C17H21NO5S2/c1-24(20,21)16-8-5-9-17(12-16)25(22,23)18-13-15(10-11-19)14-6-3-2-4-7-14/h2-9,12,15,18-19H,10-11,13H2,1H3/t15-/m0/s1 |
| InChIKey | JFFVSHRYCUGBEH-HNNXBMFYSA-N |
| XLogP | 1.53 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |