C15H19N3O5S2 — CID 75510839
1-N-(3-methoxypropyl)-3-N-pyridin-2-ylbenzene-1,3-disulfonamide (PubChem CID 75510839) has the molecular formula C15H19N3O5S2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 1-N-(3-methoxypropyl)-3-N-pyridin-2-ylbenzene-1,3-disulfonamide.
| Compound Name | 1-N-(3-methoxypropyl)-3-N-pyridin-2-ylbenzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 75510839 |
| Molecular Formula | C15H19N3O5S2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 1-N-(3-methoxypropyl)-3-N-pyridin-2-ylbenzene-1,3-disulfonamide |
| SMILES | COCCCNS(=O)(=O)c1cccc(S(=O)(=O)Nc2ccccn2)c1 |
| InChI | InChI=1S/C15H19N3O5S2/c1-23-11-5-10-17-24(19,20)13-6-4-7-14(12-13)25(21,22)18-15-8-2-3-9-16-15/h2-4,6-9,12,17H,5,10-11H2,1H3,(H,16,18) |
| InChIKey | JDLWHFWKGXWLCC-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|