C10H12INO2S — CID 22273555
N-(cyclopropylmethyl)-4-iodobenzenesulfonamide (PubChem CID 22273555) has the molecular formula C10H12INO2S and a molecular weight of 337.18 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-4-iodobenzenesulfonamide.
| Compound Name | N-(cyclopropylmethyl)-4-iodobenzenesulfonamide |
|---|---|
| PubChem CID | 22273555 |
| Molecular Formula | C10H12INO2S |
| Molecular Weight | 337.18 g/mol |
| Exact Mass | 336.96 |
| IUPAC Name | N-(cyclopropylmethyl)-4-iodobenzenesulfonamide |
| SMILES | O=S(=O)(NCC1CC1)c1ccc(I)cc1 |
| InChI | InChI=1S/C10H12INO2S/c11-9-3-5-10(6-4-9)15(13,14)12-7-8-1-2-8/h3-6,8,12H,1-2,7H2 |
| InChIKey | JJHBECGKZPZEJE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.18 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|