C11H13Cl2NO2S — CID 66007398
4-chloro-N-[(3-chlorocyclobutyl)methyl]benzenesulfonamide (PubChem CID 66007398) has the molecular formula C11H13Cl2NO2S and a molecular weight of 294.20 g/mol. Its IUPAC name is 4-chloro-N-[(3-chlorocyclobutyl)methyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[(3-chlorocyclobutyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 66007398 |
| Molecular Formula | C11H13Cl2NO2S |
| Molecular Weight | 294.20 g/mol |
| Exact Mass | 293.00 |
| IUPAC Name | 4-chloro-N-[(3-chlorocyclobutyl)methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCC1CC(Cl)C1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H13Cl2NO2S/c12-9-1-3-11(4-2-9)17(15,16)14-7-8-5-10(13)6-8/h1-4,8,10,14H,5-7H2 |
| InChIKey | MDVWVTXSKLQFAU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.20 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|