C12H13ClF3NO2S — CID 66004822
N-[(3-chlorocyclobutyl)methyl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 66004822) has the molecular formula C12H13ClF3NO2S and a molecular weight of 327.76 g/mol. Its IUPAC name is N-[(3-chlorocyclobutyl)methyl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[(3-chlorocyclobutyl)methyl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 66004822 |
| Molecular Formula | C12H13ClF3NO2S |
| Molecular Weight | 327.76 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | N-[(3-chlorocyclobutyl)methyl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCC1CC(Cl)C1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13ClF3NO2S/c13-10-4-8(5-10)7-17-20(18,19)11-3-1-2-9(6-11)12(14,15)16/h1-3,6,8,10,17H,4-5,7H2 |
| InChIKey | YWGSYNKSIFXILT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.76 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|