C14H16F3N2O4S- — CID 152770738
4-[[[3-(trifluoromethyl)phenyl]sulfonylamino]methyl]piperidine-1-carboxylate (PubChem CID 152770738) has the molecular formula C14H16F3N2O4S- and a molecular weight of 365.35 g/mol. Its IUPAC name is 4-[[[3-(trifluoromethyl)phenyl]sulfonylamino]methyl]piperidine-1-carboxylate.
| Compound Name | 4-[[[3-(trifluoromethyl)phenyl]sulfonylamino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 152770738 |
| Molecular Formula | C14H16F3N2O4S- |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | 4-[[[3-(trifluoromethyl)phenyl]sulfonylamino]methyl]piperidine-1-carboxylate |
| SMILES | O=C([O-])N1CCC(CNS(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C14H17F3N2O4S/c15-14(16,17)11-2-1-3-12(8-11)24(22,23)18-9-10-4-6-19(7-5-10)13(20)21/h1-3,8,10,18H,4-7,9H2,(H,20,21)/p-1 |
| InChIKey | JZZRLAOJCNSXSG-UHFFFAOYSA-M |
| XLogP | 1.04 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |