C14H19F3N2O2S — CID 2574466
N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 2574466) has the molecular formula C14H19F3N2O2S and a molecular weight of 336.38 g/mol. Its IUPAC name is N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 2574466 |
| Molecular Formula | C14H19F3N2O2S |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | CCN1CCC[C@@H]1CNS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H19F3N2O2S/c1-2-19-8-4-6-12(19)10-18-22(20,21)13-7-3-5-11(9-13)14(15,16)17/h3,5,7,9,12,18H,2,4,6,8,10H2,1H3/t12-/m1/s1 |
| InChIKey | VHKOATVHXIHUHT-GFCCVEGCSA-N |
| XLogP | 2.47 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |