C20H33BN2O4S — CID 140772672
N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide (PubChem CID 140772672) has the molecular formula C20H33BN2O4S and a molecular weight of 408.37 g/mol. Its IUPAC name is N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide.
| Compound Name | N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 140772672 |
| Molecular Formula | C20H33BN2O4S |
| Molecular Weight | 408.37 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide |
| SMILES | CCN1CCC[C@@H]1CNS(=O)(=O)c1ccc(C)c(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C20H33BN2O4S/c1-7-23-12-8-9-16(23)14-22-28(24,25)17-11-10-15(2)18(13-17)21-26-19(3,4)20(5,6)27-21/h10-11,13,16,22H,7-9,12,14H2,1-6H3/t16-/m1/s1 |
| InChIKey | SSWMDSGTGMWCHK-MRXNPFEDSA-N |
| XLogP | 2.06 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|