C19H25N3O2S — CID 171914644
N-[(1-ethylpyrrolidin-2-yl)methyl]-3-methyl-4-pyridin-3-ylbenzenesulfonamide (PubChem CID 171914644) has the molecular formula C19H25N3O2S and a molecular weight of 359.50 g/mol. Its IUPAC name is N-[(1-ethylpyrrolidin-2-yl)methyl]-3-methyl-4-pyridin-3-ylbenzenesulfonamide.
| Compound Name | N-[(1-ethylpyrrolidin-2-yl)methyl]-3-methyl-4-pyridin-3-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 171914644 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | N-[(1-ethylpyrrolidin-2-yl)methyl]-3-methyl-4-pyridin-3-ylbenzenesulfonamide |
| SMILES | CCN1CCCC1CNS(=O)(=O)c1ccc(-c2cccnc2)c(C)c1 |
| InChI | InChI=1S/C19H25N3O2S/c1-3-22-11-5-7-17(22)14-21-25(23,24)18-8-9-19(15(2)12-18)16-6-4-10-20-13-16/h4,6,8-10,12-13,17,21H,3,5,7,11,14H2,1-2H3 |
| InChIKey | ADUQUQRZCKWOPG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |