C16H22F3N3O3S — CID 119486455
N-[4-[3-(aminomethyl)pyrrolidin-1-yl]-4-oxobutyl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 119486455) has the molecular formula C16H22F3N3O3S and a molecular weight of 393.43 g/mol. Its IUPAC name is N-[4-[3-(aminomethyl)pyrrolidin-1-yl]-4-oxobutyl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[4-[3-(aminomethyl)pyrrolidin-1-yl]-4-oxobutyl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 119486455 |
| Molecular Formula | C16H22F3N3O3S |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | N-[4-[3-(aminomethyl)pyrrolidin-1-yl]-4-oxobutyl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | NCC1CCN(C(=O)CCCNS(=O)(=O)c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C16H22F3N3O3S/c17-16(18,19)13-3-1-4-14(9-13)26(24,25)21-7-2-5-15(23)22-8-6-12(10-20)11-22/h1,3-4,9,12,21H,2,5-8,10-11,20H2 |
| InChIKey | YFVXRGATMOCVTD-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|