C16H23ClF3N3O3S — CID 119428190
N-piperidin-3-yl-4-[[3-(trifluoromethyl)phenyl]sulfonylamino]butanamide;hydrochloride (PubChem CID 119428190) has the molecular formula C16H23ClF3N3O3S and a molecular weight of 429.89 g/mol. Its IUPAC name is N-piperidin-3-yl-4-[[3-(trifluoromethyl)phenyl]sulfonylamino]butanamide;hydrochloride.
| Compound Name | N-piperidin-3-yl-4-[[3-(trifluoromethyl)phenyl]sulfonylamino]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119428190 |
| Molecular Formula | C16H23ClF3N3O3S |
| Molecular Weight | 429.89 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | N-piperidin-3-yl-4-[[3-(trifluoromethyl)phenyl]sulfonylamino]butanamide;hydrochloride |
| SMILES | Cl.O=C(CCCNS(=O)(=O)c1cccc(C(F)(F)F)c1)NC1CCCNC1 |
| InChI | InChI=1S/C16H22F3N3O3S.ClH/c17-16(18,19)12-4-1-6-14(10-12)26(24,25)21-9-3-7-15(23)22-13-5-2-8-20-11-13;/h1,4,6,10,13,20-21H,2-3,5,7-9,11H2,(H,22,23);1H |
| InChIKey | NFYMQQSMIWHJJQ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.89 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|