C16H25N3O5S — CID 119428153
3-[(3,4-dimethoxyphenyl)sulfonylamino]-N-piperidin-3-ylpropanamide (PubChem CID 119428153) has the molecular formula C16H25N3O5S and a molecular weight of 371.46 g/mol. Its IUPAC name is 3-[(3,4-dimethoxyphenyl)sulfonylamino]-N-piperidin-3-ylpropanamide.
| Compound Name | 3-[(3,4-dimethoxyphenyl)sulfonylamino]-N-piperidin-3-ylpropanamide |
|---|---|
| PubChem CID | 119428153 |
| Molecular Formula | C16H25N3O5S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 3-[(3,4-dimethoxyphenyl)sulfonylamino]-N-piperidin-3-ylpropanamide |
| SMILES | COc1ccc(S(=O)(=O)NCCC(=O)NC2CCCNC2)cc1OC |
| InChI | InChI=1S/C16H25N3O5S/c1-23-14-6-5-13(10-15(14)24-2)25(21,22)18-9-7-16(20)19-12-4-3-8-17-11-12/h5-6,10,12,17-18H,3-4,7-9,11H2,1-2H3,(H,19,20) |
| InChIKey | YEHIEMZBTCQEGB-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |