C19H30N2O5S — CID 55913304
N-cyclohexyl-3-[(3,4-diethoxyphenyl)sulfonylamino]propanamide (PubChem CID 55913304) has the molecular formula C19H30N2O5S and a molecular weight of 398.53 g/mol. Its IUPAC name is N-cyclohexyl-3-[(3,4-diethoxyphenyl)sulfonylamino]propanamide.
| Compound Name | N-cyclohexyl-3-[(3,4-diethoxyphenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 55913304 |
| Molecular Formula | C19H30N2O5S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | N-cyclohexyl-3-[(3,4-diethoxyphenyl)sulfonylamino]propanamide |
| SMILES | CCOc1ccc(S(=O)(=O)NCCC(=O)NC2CCCCC2)cc1OCC |
| InChI | InChI=1S/C19H30N2O5S/c1-3-25-17-11-10-16(14-18(17)26-4-2)27(23,24)20-13-12-19(22)21-15-8-6-5-7-9-15/h10-11,14-15,20H,3-9,12-13H2,1-2H3,(H,21,22) |
| InChIKey | DEUPMUZJVCPCQZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |