C17H28ClN3O5S — CID 119424877
2-[(3,4-diethoxyphenyl)sulfonylamino]-N-piperidin-3-ylacetamide;hydrochloride (PubChem CID 119424877) has the molecular formula C17H28ClN3O5S and a molecular weight of 421.95 g/mol. Its IUPAC name is 2-[(3,4-diethoxyphenyl)sulfonylamino]-N-piperidin-3-ylacetamide;hydrochloride.
| Compound Name | 2-[(3,4-diethoxyphenyl)sulfonylamino]-N-piperidin-3-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119424877 |
| Molecular Formula | C17H28ClN3O5S |
| Molecular Weight | 421.95 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 2-[(3,4-diethoxyphenyl)sulfonylamino]-N-piperidin-3-ylacetamide;hydrochloride |
| SMILES | CCOc1ccc(S(=O)(=O)NCC(=O)NC2CCCNC2)cc1OCC.Cl |
| InChI | InChI=1S/C17H27N3O5S.ClH/c1-3-24-15-8-7-14(10-16(15)25-4-2)26(22,23)19-12-17(21)20-13-6-5-9-18-11-13;/h7-8,10,13,18-19H,3-6,9,11-12H2,1-2H3,(H,20,21);1H |
| InChIKey | UEADDFHEPSOLGC-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.95 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |