C21H33N3O5S — CID 56569415
3-[(3,4-dimethoxyphenyl)sulfonylamino]-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]propanamide (PubChem CID 56569415) has the molecular formula C21H33N3O5S and a molecular weight of 439.58 g/mol. Its IUPAC name is 3-[(3,4-dimethoxyphenyl)sulfonylamino]-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]propanamide.
| Compound Name | 3-[(3,4-dimethoxyphenyl)sulfonylamino]-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 56569415 |
| Molecular Formula | C21H33N3O5S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | 3-[(3,4-dimethoxyphenyl)sulfonylamino]-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]propanamide |
| SMILES | COc1ccc(S(=O)(=O)NCCC(=O)NC2CCN(CC=C(C)C)CC2)cc1OC |
| InChI | InChI=1S/C21H33N3O5S/c1-16(2)8-12-24-13-9-17(10-14-24)23-21(25)7-11-22-30(26,27)18-5-6-19(28-3)20(15-18)29-4/h5-6,8,15,17,22H,7,9-14H2,1-4H3,(H,23,25) |
| InChIKey | STMIYZMWUWYUGU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|