C14H23N3O5S — CID 119408095
N-(3-aminopropyl)-3-[(3,4-dimethoxyphenyl)sulfonylamino]propanamide (PubChem CID 119408095) has the molecular formula C14H23N3O5S and a molecular weight of 345.42 g/mol. Its IUPAC name is N-(3-aminopropyl)-3-[(3,4-dimethoxyphenyl)sulfonylamino]propanamide.
| Compound Name | N-(3-aminopropyl)-3-[(3,4-dimethoxyphenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 119408095 |
| Molecular Formula | C14H23N3O5S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | N-(3-aminopropyl)-3-[(3,4-dimethoxyphenyl)sulfonylamino]propanamide |
| SMILES | COc1ccc(S(=O)(=O)NCCC(=O)NCCCN)cc1OC |
| InChI | InChI=1S/C14H23N3O5S/c1-21-12-5-4-11(10-13(12)22-2)23(19,20)17-9-6-14(18)16-8-3-7-15/h4-5,10,17H,3,6-9,15H2,1-2H3,(H,16,18) |
| InChIKey | JXYMHULTKZGYBI-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|