C24H30N4O5S — CID 46473166
3-[(3,4-dimethoxyphenyl)sulfonylamino]-N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]propanamide (PubChem CID 46473166) has the molecular formula C24H30N4O5S and a molecular weight of 486.59 g/mol. Its IUPAC name is 3-[(3,4-dimethoxyphenyl)sulfonylamino]-N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]propanamide.
| Compound Name | 3-[(3,4-dimethoxyphenyl)sulfonylamino]-N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]propanamide |
|---|---|
| PubChem CID | 46473166 |
| Molecular Formula | C24H30N4O5S |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 3-[(3,4-dimethoxyphenyl)sulfonylamino]-N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]propanamide |
| SMILES | COc1ccc(S(=O)(=O)NCCC(=O)NCCCc2cn(-c3ccccc3)nc2C)cc1OC |
| InChI | InChI=1S/C24H30N4O5S/c1-18-19(17-28(27-18)20-9-5-4-6-10-20)8-7-14-25-24(29)13-15-26-34(30,31)21-11-12-22(32-2)23(16-21)33-3/h4-6,9-12,16-17,26H,7-8,13-15H2,1-3H3,(H,25,29) |
| InChIKey | KVNWBPLFUGXGHT-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|